C14H13F3INO2 — CID 25192669
(4R,8aS)-7-iodo-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 25192669) has the molecular formula C14H13F3INO2 and a molecular weight of 411.16 g/mol. Its IUPAC name is (4R,8aS)-7-iodo-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4R,8aS)-7-iodo-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 25192669 |
| Molecular Formula | C14H13F3INO2 |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | (4R,8aS)-7-iodo-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N2CC(I)C[C@@]12C(F)(F)F |
| InChI | InChI=1S/C14H13F3INO2/c15-14(16,17)13-6-10(18)7-19(13)11(8-21-12(13)20)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10?,11-,13-/m0/s1 |
| InChIKey | COHAUXUCAPKXSK-KUNJKIHDSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|