About 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile
8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile (PubChem CID 25192789) has the molecular formula C25H12Cl2N4
and a molecular weight of 439.31 g/mol. Its IUPAC name is 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile.
Molecular Properties
| Compound Name | 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile |
| PubChem CID | 25192789 |
| Molecular Formula | C25H12Cl2N4 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile |
| SMILES | N#Cc1c(-c2cccc(Cl)c2)c(-c2cccc(Cl)c2)c2c(nc3ccccn32)c1C#N |
| InChI | InChI=1S/C25H12Cl2N4/c26-17-7-3-5-15(11-17)22-19(13-28)20(14-29)24-25(31-10-2-1-9-21(31)30-24)23(22)16-6-4-8-18(27)12-16/h1-12H |
| InChIKey | JKTGSCYOZVNEJS-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile?
The IUPAC name of 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile (CID 25192789) is 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile.
What is the SMILES notation for 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile?
The canonical SMILES for 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile is N#Cc1c(-c2cccc(Cl)c2)c(-c2cccc(Cl)c2)c2c(nc3ccccn32)c1C#N.
What is the InChIKey of 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile?
The InChIKey is JKTGSCYOZVNEJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H12Cl2N4/c26-17-7-3-5-15(11-17)22-19(13-28)20(14-29)24-25(31-10-2-1-9-21(31)30-24)23(22)16-6-4-8-18(27)12-16/h1-12H.
What are the key properties of 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile?
8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile has a molecular weight of 439.31 g/mol, XLogP of 6.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-bis(3-chlorophenyl)pyrido[1,2-a]benzimidazole-6,7-dicarbonitrile is sourced from PubChem (CID 25192789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).