C19H21NO3S — CID 25193005
1-(4-methoxyphenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine (PubChem CID 25193005) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 25193005 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC=C(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-23-18-9-11-19(12-10-18)24(21,22)20-14-5-8-17(13-15-20)16-6-3-2-4-7-16/h2-4,6-12H,5,13-15H2,1H3 |
| InChIKey | IZVJVOFBODYIPK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |