C18H17Cl2NO2S — CID 25193009
1-(2,4-dichlorophenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine (PubChem CID 25193009) has the molecular formula C18H17Cl2NO2S and a molecular weight of 382.31 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-(2,4-dichlorophenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 25193009 |
| Molecular Formula | C18H17Cl2NO2S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)sulfonyl-4-phenyl-2,3,6,7-tetrahydroazepine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1Cl)N1CCC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17Cl2NO2S/c19-16-8-9-18(17(20)13-16)24(22,23)21-11-4-7-15(10-12-21)14-5-2-1-3-6-14/h1-3,5-9,13H,4,10-12H2 |
| InChIKey | RWTILBWJCNPBSR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |