About ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate
ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 25193326) has the molecular formula C22H19F2NO5
and a molecular weight of 415.39 g/mol. Its IUPAC name is ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate |
| PubChem CID | 25193326 |
| Molecular Formula | C22H19F2NO5 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | CCOC(=O)C(=O)/C=C(\O)c1cn(Cc2cccc(F)c2F)c2cccc(OC)c12 |
| InChI | InChI=1S/C22H19F2NO5/c1-3-30-22(28)18(27)10-17(26)14-12-25(11-13-6-4-7-15(23)21(13)24)16-8-5-9-19(29-2)20(14)16/h4-10,12,26H,3,11H2,1-2H3/b17-10- |
| InChIKey | KRPSRLFYIFXWJZ-YVLHZVERSA-N |
| XLogP | 4.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate?
The IUPAC name of ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate (CID 25193326) is ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate.
What is the SMILES notation for ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate?
The canonical SMILES for ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate is CCOC(=O)C(=O)/C=C(\O)c1cn(Cc2cccc(F)c2F)c2cccc(OC)c12.
What is the InChIKey of ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate?
The InChIKey is KRPSRLFYIFXWJZ-YVLHZVERSA-N. The full InChI is InChI=1S/C22H19F2NO5/c1-3-30-22(28)18(27)10-17(26)14-12-25(11-13-6-4-7-15(23)21(13)24)16-8-5-9-19(29-2)20(14)16/h4-10,12,26H,3,11H2,1-2H3/b17-10-.
What are the key properties of ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate?
ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate has a molecular weight of 415.39 g/mol, XLogP of 4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-4-[1-[(2,3-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate is sourced from PubChem (CID 25193326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).