C23H24O7S — CID 25193653
[(2R,4aR,6R,7S,8S,8aR)-7-acetyloxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 25193653) has the molecular formula C23H24O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is [(2R,4aR,6R,7S,8S,8aR)-7-acetyloxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(2R,4aR,6R,7S,8S,8aR)-7-acetyloxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 25193653 |
| Molecular Formula | C23H24O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [(2R,4aR,6R,7S,8S,8aR)-7-acetyloxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](Sc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C23H24O7S/c1-14(24)27-20-19-18(13-26-22(30-19)16-9-5-3-6-10-16)29-23(21(20)28-15(2)25)31-17-11-7-4-8-12-17/h3-12,18-23H,13H2,1-2H3/t18-,19-,20+,21+,22-,23-/m1/s1 |
| InChIKey | GCQPLYFPSCZIAK-WSJQOYCOSA-N |
| XLogP | 3.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |