C8H10F3NO2 — CID 25193828
5-(3,3,3-trifluoropropyl)piperidine-2,4-dione (PubChem CID 25193828) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is 5-(3,3,3-trifluoropropyl)piperidine-2,4-dione.
| Compound Name | 5-(3,3,3-trifluoropropyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 25193828 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 5-(3,3,3-trifluoropropyl)piperidine-2,4-dione |
| SMILES | O=C1CC(=O)C(CCC(F)(F)F)CN1 |
| InChI | InChI=1S/C8H10F3NO2/c9-8(10,11)2-1-5-4-12-7(14)3-6(5)13/h5H,1-4H2,(H,12,14) |
| InChIKey | MKKTWJSCERFMAN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|