C33H30BrNO4 — CID 25194028
9,10-dimethoxy-2,3-bis(phenylmethoxy)-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide (PubChem CID 25194028) has the molecular formula C33H30BrNO4 and a molecular weight of 584.51 g/mol. Its IUPAC name is 9,10-dimethoxy-2,3-bis(phenylmethoxy)-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide.
| Compound Name | 9,10-dimethoxy-2,3-bis(phenylmethoxy)-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide |
|---|---|
| PubChem CID | 25194028 |
| Molecular Formula | C33H30BrNO4 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | 9,10-dimethoxy-2,3-bis(phenylmethoxy)-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc(OCc2ccccc2)c(OCc2ccccc2)cc1-3.[Br-] |
| InChI | InChI=1S/C33H30NO4.BrH/c1-35-30-14-13-25-17-29-27-19-32(38-22-24-11-7-4-8-12-24)31(37-21-23-9-5-3-6-10-23)18-26(27)15-16-34(29)20-28(25)33(30)36-2;/h3-14,17-20H,15-16,21-22H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ONFLOWLHWHEFQE-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|