About (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine
(5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 25194895) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 25194895 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | NCC[C@H]1CN=C(N)N1 |
| InChI | InChI=1S/C5H12N4/c6-2-1-4-3-8-5(7)9-4/h4H,1-3,6H2,(H3,7,8,9)/t4-/m0/s1 |
| InChIKey | BEVLBOZRNWAWDO-BYPYZUCNSA-N |
| XLogP | -1.38 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine (CID 25194895) is (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine is NCC[C@H]1CN=C(N)N1.
What is the InChIKey of (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is BEVLBOZRNWAWDO-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H12N4/c6-2-1-4-3-8-5(7)9-4/h4H,1-3,6H2,(H3,7,8,9)/t4-/m0/s1.
What are the key properties of (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine?
(5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 128.18 g/mol, XLogP of -1.38, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 25194895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).