About 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol
2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol (PubChem CID 25195074) has the molecular formula C13H12O3S
and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol |
| PubChem CID | 25195074 |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol |
| SMILES | O=S(=O)(C1=C(O)C=CCC=C1)c1ccccc1 |
| InChI | InChI=1S/C13H12O3S/c14-12-9-5-2-6-10-13(12)17(15,16)11-7-3-1-4-8-11/h1,3-10,14H,2H2 |
| InChIKey | YERYZZRYNPUVLL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol?
The IUPAC name of 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol (CID 25195074) is 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol.
What is the SMILES notation for 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol?
The canonical SMILES for 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol is O=S(=O)(C1=C(O)C=CCC=C1)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol?
The InChIKey is YERYZZRYNPUVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3S/c14-12-9-5-2-6-10-13(12)17(15,16)11-7-3-1-4-8-11/h1,3-10,14H,2H2.
What are the key properties of 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol?
2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol has a molecular weight of 248.30 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)cyclohepta-1,3,6-trien-1-ol is sourced from PubChem (CID 25195074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).