C14H16O4 — CID 25195075
ethyl (4aS,9aR)-2,5-dioxo-1,8,9,9a-tetrahydrobenzo[7]annulene-4a-carboxylate (PubChem CID 25195075) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethyl (4aS,9aR)-2,5-dioxo-1,8,9,9a-tetrahydrobenzo[7]annulene-4a-carboxylate.
| Compound Name | ethyl (4aS,9aR)-2,5-dioxo-1,8,9,9a-tetrahydrobenzo[7]annulene-4a-carboxylate |
|---|---|
| PubChem CID | 25195075 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethyl (4aS,9aR)-2,5-dioxo-1,8,9,9a-tetrahydrobenzo[7]annulene-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12C=CC(=O)C[C@H]1CCC=CC2=O |
| InChI | InChI=1S/C14H16O4/c1-2-18-13(17)14-8-7-11(15)9-10(14)5-3-4-6-12(14)16/h4,6-8,10H,2-3,5,9H2,1H3/t10-,14-/m1/s1 |
| InChIKey | IDKGHAITBWUVOG-QMTHXVAHSA-N |
| XLogP | 1.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|