About propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate
propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate (PubChem CID 25195090) has the molecular formula C18H14Cl3N3O2
and a molecular weight of 410.69 g/mol. Its IUPAC name is propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate.
Molecular Properties
| Compound Name | propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate |
| PubChem CID | 25195090 |
| Molecular Formula | C18H14Cl3N3O2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate |
| SMILES | CCCOC(=O)c1nnn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl3N3O2/c1-2-9-26-18(25)16-17(11-3-5-12(19)6-4-11)24(23-22-16)15-8-7-13(20)10-14(15)21/h3-8,10H,2,9H2,1H3 |
| InChIKey | ZJHQAQCOXXBING-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
The IUPAC name of propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate (CID 25195090) is propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate.
What is the SMILES notation for propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
The canonical SMILES for propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate is CCCOC(=O)c1nnn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1.
What is the InChIKey of propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
The InChIKey is ZJHQAQCOXXBING-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl3N3O2/c1-2-9-26-18(25)16-17(11-3-5-12(19)6-4-11)24(23-22-16)15-8-7-13(20)10-14(15)21/h3-8,10H,2,9H2,1H3.
What are the key properties of propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate has a molecular weight of 410.69 g/mol, XLogP of 5.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate is sourced from PubChem (CID 25195090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).