C23H26F2N4O2 — CID 25195612
N-[4-[2-(diethylamino)ethoxy]phenyl]-5-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine (PubChem CID 25195612) has the molecular formula C23H26F2N4O2 and a molecular weight of 428.48 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)ethoxy]phenyl]-5-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | N-[4-[2-(diethylamino)ethoxy]phenyl]-5-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 25195612 |
| Molecular Formula | C23H26F2N4O2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[4-[2-(diethylamino)ethoxy]phenyl]-5-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine |
| SMILES | CCN(CC)CCOc1ccc(Nc2ncc(-c3ccc(OC(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C23H26F2N4O2/c1-3-29(4-2)13-14-30-20-11-7-19(8-12-20)28-23-26-15-18(16-27-23)17-5-9-21(10-6-17)31-22(24)25/h5-12,15-16,22H,3-4,13-14H2,1-2H3,(H,26,27,28) |
| InChIKey | LLYGZUJJDAOTQL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |