C26H33F2N3O3 — CID 25195677
(3S)-N-(2,2-difluoroethyl)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide (PubChem CID 25195677) has the molecular formula C26H33F2N3O3 and a molecular weight of 473.56 g/mol. Its IUPAC name is (3S)-N-(2,2-difluoroethyl)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(2,2-difluoroethyl)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 25195677 |
| Molecular Formula | C26H33F2N3O3 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (3S)-N-(2,2-difluoroethyl)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidine-3-carboxamide |
| SMILES | Cn1c2c(c3cc(C(=O)N4CC[C@H](C(=O)NCC(F)F)C4)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C26H33F2N3O3/c1-30-22-4-2-17(16-7-10-34-11-8-16)12-20(22)21-13-18(3-5-23(21)30)26(33)31-9-6-19(15-31)25(32)29-14-24(27)28/h3,5,13,16-17,19,24H,2,4,6-12,14-15H2,1H3,(H,29,32)/t17?,19-/m0/s1 |
| InChIKey | HBHGAIUORWGVQY-NNBQYGFHSA-N |
| XLogP | 3.55 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|