About 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide
2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 25195692) has the molecular formula C13H13BrF3N3O2S
and a molecular weight of 412.23 g/mol. Its IUPAC name is 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 25195692 |
| Molecular Formula | C13H13BrF3N3O2S |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | C[C@H]1C[C@@H](NS(=O)(=O)c2cc(C(F)(F)F)ccc2Br)CN1C#N |
| InChI | InChI=1S/C13H13BrF3N3O2S/c1-8-4-10(6-20(8)7-18)19-23(21,22)12-5-9(13(15,16)17)2-3-11(12)14/h2-3,5,8,10,19H,4,6H2,1H3/t8-,10+/m0/s1 |
| InChIKey | DLJFCFLYWNHYPL-WCBMZHEXSA-N |
| XLogP | 2.69 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide (CID 25195692) is 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide is C[C@H]1C[C@@H](NS(=O)(=O)c2cc(C(F)(F)F)ccc2Br)CN1C#N.
What is the InChIKey of 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide?
The InChIKey is DLJFCFLYWNHYPL-WCBMZHEXSA-N. The full InChI is InChI=1S/C13H13BrF3N3O2S/c1-8-4-10(6-20(8)7-18)19-23(21,22)12-5-9(13(15,16)17)2-3-11(12)14/h2-3,5,8,10,19H,4,6H2,1H3/t8-,10+/m0/s1.
What are the key properties of 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide?
2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide has a molecular weight of 412.23 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(3R,5S)-1-cyano-5-methylpyrrolidin-3-yl]-5-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 25195692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).