C25H27N9O4S2 — CID 25195904
4-N-(1-methylsulfonylindazol-6-yl)-2-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 25195904) has the molecular formula C25H27N9O4S2 and a molecular weight of 581.68 g/mol. Its IUPAC name is 4-N-(1-methylsulfonylindazol-6-yl)-2-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1-methylsulfonylindazol-6-yl)-2-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25195904 |
| Molecular Formula | C25H27N9O4S2 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 4-N-(1-methylsulfonylindazol-6-yl)-2-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(Nc3nc(Nc4ccc5cnn(S(C)(=O)=O)c5c4)c4cc[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C25H27N9O4S2/c1-39(35,36)33-13-11-32(12-14-33)20-7-5-18(6-8-20)29-25-30-23-21(9-10-26-23)24(31-25)28-19-4-3-17-16-27-34(22(17)15-19)40(2,37)38/h3-10,15-16H,11-14H2,1-2H3,(H3,26,28,29,30,31) |
| InChIKey | CKSNURPBQJSTFF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|