C27H39FN2O4S — CID 25195987
(3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3-methoxypropyl)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 25195987) has the molecular formula C27H39FN2O4S and a molecular weight of 506.68 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3-methoxypropyl)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3-methoxypropyl)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 25195987 |
| Molecular Formula | C27H39FN2O4S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3-methoxypropyl)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | COCCCc1cc(C[C@@H]2CS(=O)(=O)C[C@H](NCc3cccc(C(C)(C)C)c3)[C@H]2O)cc(F)c1N |
| InChI | InChI=1S/C27H39FN2O4S/c1-27(2,3)22-9-5-7-18(13-22)15-30-24-17-35(32,33)16-21(26(24)31)12-19-11-20(8-6-10-34-4)25(29)23(28)14-19/h5,7,9,11,13-14,21,24,26,30-31H,6,8,10,12,15-17,29H2,1-4H3/t21-,24+,26+/m1/s1 |
| InChIKey | SACQJWKJKRFHGH-DSBYRVASSA-N |
| XLogP | 3.39 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|