About 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one
3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 25196026) has the molecular formula C19H12Cl2FN3OS
and a molecular weight of 420.30 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 25196026 |
| Molecular Formula | C19H12Cl2FN3OS |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2nc(-c2ccc(F)cc2)n1NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2FN3OS/c20-14-6-1-11(9-15(14)21)10-23-25-18(12-2-4-13(22)5-3-12)24-16-7-8-27-17(16)19(25)26/h1-9,23H,10H2 |
| InChIKey | FBLMJWUHQUYLLK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one (CID 25196026) is 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one is O=c1c2sccc2nc(-c2ccc(F)cc2)n1NCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one?
The InChIKey is FBLMJWUHQUYLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2FN3OS/c20-14-6-1-11(9-15(14)21)10-23-25-18(12-2-4-13(22)5-3-12)24-16-7-8-27-17(16)19(25)26/h1-9,23H,10H2.
What are the key properties of 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one?
3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one has a molecular weight of 420.30 g/mol, XLogP of 5.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dichlorophenyl)methylamino]-2-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 25196026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).