About [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate (PubChem CID 25196075) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate.
Molecular Properties
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate |
| PubChem CID | 25196075 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate |
| SMILES | CCNC(=O)C(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C14H25NO3/c1-5-15-13(16)14(17)18-12-8-10(4)6-7-11(12)9(2)3/h9-12H,5-8H2,1-4H3,(H,15,16)/t10-,11+,12-/m0/s1 |
| InChIKey | VTSKTHILUKZQTB-TUAOUCFPSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate?
The IUPAC name of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate (CID 25196075) is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate.
What is the SMILES notation for [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate?
The canonical SMILES for [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate is CCNC(=O)C(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C.
What is the InChIKey of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate?
The InChIKey is VTSKTHILUKZQTB-TUAOUCFPSA-N. The full InChI is InChI=1S/C14H25NO3/c1-5-15-13(16)14(17)18-12-8-10(4)6-7-11(12)9(2)3/h9-12H,5-8H2,1-4H3,(H,15,16)/t10-,11+,12-/m0/s1.
What are the key properties of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate?
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate has a molecular weight of 255.36 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(ethylamino)-2-oxoacetate is sourced from PubChem (CID 25196075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).