C20H20Br2N4O3S — CID 25196125
N-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-2-phenylacetamide (PubChem CID 25196125) has the molecular formula C20H20Br2N4O3S and a molecular weight of 556.28 g/mol. Its IUPAC name is N-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-2-phenylacetamide.
| Compound Name | N-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 25196125 |
| Molecular Formula | C20H20Br2N4O3S |
| Molecular Weight | 556.28 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | N-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-2-phenylacetamide |
| SMILES | N#CN1C[C@H](NS(=O)(=O)c2cc(Br)ccc2Br)C[C@@H]1CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H20Br2N4O3S/c21-15-6-7-18(22)19(9-15)30(28,29)25-16-10-17(26(12-16)13-23)11-24-20(27)8-14-4-2-1-3-5-14/h1-7,9,16-17,25H,8,10-12H2,(H,24,27)/t16-,17-/m1/s1 |
| InChIKey | CWQBKGYQLWHBJZ-IAGOWNOFSA-N |
| XLogP | 2.77 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|