C27H31N3O4S — CID 25196271
tert-butyl 2-[3-(benzenesulfonyl)quinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 25196271) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is tert-butyl 2-[3-(benzenesulfonyl)quinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[3-(benzenesulfonyl)quinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25196271 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | tert-butyl 2-[3-(benzenesulfonyl)quinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(c3cccc4cc(S(=O)(=O)c5ccccc5)cnc34)CC2C1 |
| InChI | InChI=1S/C27H31N3O4S/c1-27(2,3)34-26(31)29-13-12-20-16-30(18-21(20)17-29)24-11-7-8-19-14-23(15-28-25(19)24)35(32,33)22-9-5-4-6-10-22/h4-11,14-15,20-21H,12-13,16-18H2,1-3H3 |
| InChIKey | ZSYWDXXFIFSONJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |