C27H36F3N3O3 — CID 25196324
9-ethyl-N-methyl-6-(oxan-4-yl)-N-[4-oxo-4-(2,2,2-trifluoroethylamino)butyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 25196324) has the molecular formula C27H36F3N3O3 and a molecular weight of 507.60 g/mol. Its IUPAC name is 9-ethyl-N-methyl-6-(oxan-4-yl)-N-[4-oxo-4-(2,2,2-trifluoroethylamino)butyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-ethyl-N-methyl-6-(oxan-4-yl)-N-[4-oxo-4-(2,2,2-trifluoroethylamino)butyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 25196324 |
| Molecular Formula | C27H36F3N3O3 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 9-ethyl-N-methyl-6-(oxan-4-yl)-N-[4-oxo-4-(2,2,2-trifluoroethylamino)butyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CCn1c2c(c3cc(C(=O)N(C)CCCC(=O)NCC(F)(F)F)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C27H36F3N3O3/c1-3-33-23-8-6-19(18-10-13-36-14-11-18)15-21(23)22-16-20(7-9-24(22)33)26(35)32(2)12-4-5-25(34)31-17-27(28,29)30/h7,9,16,18-19H,3-6,8,10-15,17H2,1-2H3,(H,31,34) |
| InChIKey | UMBICBFHANKFPB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|