About [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate
[2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 2519634) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate.
Molecular Properties
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate |
| PubChem CID | 2519634 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)OCC(=O)NC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-13-8-9-14(2)16(10-13)18(23)25-12-17(22)21-19(24)20-11-15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | MJNDDXOWGJUODJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate?
The IUPAC name of [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate (CID 2519634) is [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate.
What is the SMILES notation for [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate?
The canonical SMILES for [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate is Cc1ccc(C)c(C(=O)OCC(=O)NC(=O)NCc2ccccc2)c1.
What is the InChIKey of [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate?
The InChIKey is MJNDDXOWGJUODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-13-8-9-14(2)16(10-13)18(23)25-12-17(22)21-19(24)20-11-15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3,(H2,20,21,22,24).
What are the key properties of [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate?
[2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate has a molecular weight of 340.38 g/mol, XLogP of 2.49, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylcarbamoylamino)-2-oxoethyl] 2,5-dimethylbenzoate is sourced from PubChem (CID 2519634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).