C29H33ClN4O3 — CID 25196356
(2R,8S)-13-chloro-2-(3-hydroxyphenyl)-8-methyl-6-[2-(4-methylpiperidin-1-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 25196356) has the molecular formula C29H33ClN4O3 and a molecular weight of 521.06 g/mol. Its IUPAC name is (2R,8S)-13-chloro-2-(3-hydroxyphenyl)-8-methyl-6-[2-(4-methylpiperidin-1-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8S)-13-chloro-2-(3-hydroxyphenyl)-8-methyl-6-[2-(4-methylpiperidin-1-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 25196356 |
| Molecular Formula | C29H33ClN4O3 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (2R,8S)-13-chloro-2-(3-hydroxyphenyl)-8-methyl-6-[2-(4-methylpiperidin-1-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC1CCN(CCN2CC(=O)N3[C@H](c4cccc(O)c4)c4[nH]c5ccc(Cl)cc5c4C[C@@]3(C)C2=O)CC1 |
| InChI | InChI=1S/C29H33ClN4O3/c1-18-8-10-32(11-9-18)12-13-33-17-25(36)34-27(19-4-3-5-21(35)14-19)26-23(16-29(34,2)28(33)37)22-15-20(30)6-7-24(22)31-26/h3-7,14-15,18,27,31,35H,8-13,16-17H2,1-2H3/t27-,29+/m1/s1 |
| InChIKey | PPRJAZLCGOZKRL-PXJZQJOASA-N |
| XLogP | 4.33 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|