C27H30FN3O4S — CID 25196387
tert-butyl 2-[3-(4-fluorophenyl)sulfonylquinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 25196387) has the molecular formula C27H30FN3O4S and a molecular weight of 511.62 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-fluorophenyl)sulfonylquinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[3-(4-fluorophenyl)sulfonylquinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25196387 |
| Molecular Formula | C27H30FN3O4S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | tert-butyl 2-[3-(4-fluorophenyl)sulfonylquinolin-8-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(c3cccc4cc(S(=O)(=O)c5ccc(F)cc5)cnc34)CC2C1 |
| InChI | InChI=1S/C27H30FN3O4S/c1-27(2,3)35-26(32)30-12-11-19-15-31(17-20(19)16-30)24-6-4-5-18-13-23(14-29-25(18)24)36(33,34)22-9-7-21(28)8-10-22/h4-10,13-14,19-20H,11-12,15-17H2,1-3H3 |
| InChIKey | VMNPOBJPNAVOOT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |