C10H11N3O3S — CID 25196615
4-(3,4-dimethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 25196615) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 25196615 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | COc1ccc(-n2c(=O)[nH][nH]c2=S)cc1OC |
| InChI | InChI=1S/C10H11N3O3S/c1-15-7-4-3-6(5-8(7)16-2)13-9(14)11-12-10(13)17/h3-5H,1-2H3,(H,11,14)(H,12,17) |
| InChIKey | XXZNTUSNQNUKOI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|