C11H6N6O5S2 — CID 25196726
4-(4-nitrophenyl)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 25196726) has the molecular formula C11H6N6O5S2 and a molecular weight of 366.34 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(4-nitrophenyl)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 25196726 |
| Molecular Formula | C11H6N6O5S2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 4-(4-nitrophenyl)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(Sc2ncc([N+](=O)[O-])s2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H6N6O5S2/c18-9-13-14-10(24-11-12-5-8(23-11)17(21)22)15(9)6-1-3-7(4-2-6)16(19)20/h1-5H,(H,13,18) |
| InChIKey | PWPAEPVDSKUANZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|