C8H5F2N3OS — CID 25196727
4-(3,4-difluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 25196727) has the molecular formula C8H5F2N3OS and a molecular weight of 229.21 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(3,4-difluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 25196727 |
| Molecular Formula | C8H5F2N3OS |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4-(3,4-difluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H5F2N3OS/c9-5-2-1-4(3-6(5)10)13-7(14)11-12-8(13)15/h1-3H,(H,11,14)(H,12,15) |
| InChIKey | CGUHCZBFDGAJEG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|