C25H22Br2FN5O3S — CID 25196803
1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[3-(4-fluorophenyl)phenyl]urea (PubChem CID 25196803) has the molecular formula C25H22Br2FN5O3S and a molecular weight of 651.36 g/mol. Its IUPAC name is 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[3-(4-fluorophenyl)phenyl]urea.
| Compound Name | 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[3-(4-fluorophenyl)phenyl]urea |
|---|---|
| PubChem CID | 25196803 |
| Molecular Formula | C25H22Br2FN5O3S |
| Molecular Weight | 651.36 g/mol |
| Exact Mass | 648.98 |
| IUPAC Name | 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[3-(4-fluorophenyl)phenyl]urea |
| SMILES | N#CN1C[C@H](NS(=O)(=O)c2cc(Br)ccc2Br)C[C@@H]1CNC(=O)Nc1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H22Br2FN5O3S/c26-18-6-9-23(27)24(11-18)37(35,36)32-21-12-22(33(14-21)15-29)13-30-25(34)31-20-3-1-2-17(10-20)16-4-7-19(28)8-5-16/h1-11,21-22,32H,12-14H2,(H2,30,31,34)/t21-,22-/m1/s1 |
| InChIKey | GKIYTKGXVKVJJK-FGZHOGPDSA-N |
| XLogP | 5.04 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|