C20H20Br2FN5O3S — CID 25196805
1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 25196805) has the molecular formula C20H20Br2FN5O3S and a molecular weight of 589.29 g/mol. Its IUPAC name is 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 25196805 |
| Molecular Formula | C20H20Br2FN5O3S |
| Molecular Weight | 589.29 g/mol |
| Exact Mass | 586.96 |
| IUPAC Name | 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | N#CN1C[C@H](NS(=O)(=O)c2cc(Br)ccc2Br)C[C@@H]1CNC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20Br2FN5O3S/c21-14-3-6-18(22)19(7-14)32(30,31)27-16-8-17(28(11-16)12-24)10-26-20(29)25-9-13-1-4-15(23)5-2-13/h1-7,16-17,27H,8-11H2,(H2,25,26,29)/t16-,17-/m1/s1 |
| InChIKey | LUCMRSQAOUDMIA-IAGOWNOFSA-N |
| XLogP | 3.05 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|