C21H17Br2F6N5O3S — CID 25196916
1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]urea (PubChem CID 25196916) has the molecular formula C21H17Br2F6N5O3S and a molecular weight of 693.26 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 25196916 |
| Molecular Formula | C21H17Br2F6N5O3S |
| Molecular Weight | 693.26 g/mol |
| Exact Mass | 690.93 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]urea |
| SMILES | N#CN1C[C@H](NS(=O)(=O)c2cc(Br)ccc2Br)C[C@@H]1CNC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17Br2F6N5O3S/c22-13-1-2-17(23)18(6-13)38(36,37)33-15-7-16(34(9-15)10-30)8-31-19(35)32-14-4-11(20(24,25)26)3-12(5-14)21(27,28)29/h1-6,15-16,33H,7-9H2,(H2,31,32,35)/t15-,16-/m1/s1 |
| InChIKey | WTAAQBAMAJPBLJ-HZPDHXFCSA-N |
| XLogP | 5.27 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|