C28H45FN2O5 — CID 25197067
[(2R,4R,6R,7R,9S,14R)-4-(fluoromethyl)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(1-methylpiperidine-4-carbonyl)carbamate (PubChem CID 25197067) has the molecular formula C28H45FN2O5 and a molecular weight of 508.68 g/mol. Its IUPAC name is [(2R,4R,6R,7R,9S,14R)-4-(fluoromethyl)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(1-methylpiperidine-4-carbonyl)carbamate.
| Compound Name | [(2R,4R,6R,7R,9S,14R)-4-(fluoromethyl)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(1-methylpiperidine-4-carbonyl)carbamate |
|---|---|
| PubChem CID | 25197067 |
| Molecular Formula | C28H45FN2O5 |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | [(2R,4R,6R,7R,9S,14R)-4-(fluoromethyl)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(1-methylpiperidine-4-carbonyl)carbamate |
| SMILES | COC1CCC23CC[C@@H](C)[C@](C)(C12)[C@H](OC(=O)NC(=O)C1CCN(C)CC1)C[C@@](C)(CF)C(=O)[C@@H]3C |
| InChI | InChI=1S/C28H45FN2O5/c1-17-7-11-28-12-8-20(35-6)22(28)27(17,4)21(15-26(3,16-29)23(32)18(28)2)36-25(34)30-24(33)19-9-13-31(5)14-10-19/h17-22H,7-16H2,1-6H3,(H,30,33,34)/t17-,18+,20?,21-,22?,26+,27+,28?/m1/s1 |
| InChIKey | MBBZQGCHFMDFAP-KOCWVISUSA-N |
| XLogP | 4.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |