C25H35N3O3 — CID 25197227
N,9-dimethyl-N-[4-(methylamino)-4-oxobutyl]-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 25197227) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N,9-dimethyl-N-[4-(methylamino)-4-oxobutyl]-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N,9-dimethyl-N-[4-(methylamino)-4-oxobutyl]-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 25197227 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N,9-dimethyl-N-[4-(methylamino)-4-oxobutyl]-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CNC(=O)CCCN(C)C(=O)c1ccc2c(c1)c1c(n2C)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C25H35N3O3/c1-26-24(29)5-4-12-27(2)25(30)19-7-9-23-21(16-19)20-15-18(6-8-22(20)28(23)3)17-10-13-31-14-11-17/h7,9,16-18H,4-6,8,10-15H2,1-3H3,(H,26,29) |
| InChIKey | LYYAOAAEQUTERQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|