C30H41NO3 — CID 25197280
(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-N,2,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide (PubChem CID 25197280) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-N,2,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-N,2,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 25197280 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-N,2,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
| SMILES | CNC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C30H41NO3/c1-18-19-8-9-22-28(4,20(19)16-21(32)24(18)33)13-15-30(6)23-17-27(3,25(34)31-7)11-10-26(23,2)12-14-29(22,30)5/h8-9,16,23,33H,10-15,17H2,1-7H3,(H,31,34)/t23-,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | ZNFSSQAJGMMWBY-WXPPGMDDSA-N |
| XLogP | 6.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |