About CID 25197322
CID 25197322 (PubChem CID 25197322) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol.
Molecular Properties
| Compound Name | CID 25197322 |
| PubChem CID | 25197322 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | — |
| SMILES | CN1[C]N(C(=O)N2CCCC2)C=C1 |
| InChI | InChI=1S/C9H13N3O/c1-10-6-7-12(8-10)9(13)11-4-2-3-5-11/h6-7H,2-5H2,1H3 |
| InChIKey | UKUHURDXYCWASI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 25197322 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25197322?
The IUPAC name of CID 25197322 (CID 25197322) is not available.
What is the SMILES notation for CID 25197322?
The canonical SMILES for CID 25197322 is CN1[C]N(C(=O)N2CCCC2)C=C1.
What is the InChIKey of CID 25197322?
The InChIKey is UKUHURDXYCWASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-10-6-7-12(8-10)9(13)11-4-2-3-5-11/h6-7H,2-5H2,1H3.
What are the key properties of CID 25197322?
CID 25197322 has a molecular weight of 179.22 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25197322 is sourced from PubChem (CID 25197322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).