C10H20O6 — CID 25197463
cis-(1R,3S)-2-(2-hydroxyethyl)-5,5-dimethoxycyclohexane-1,2,3-triol (PubChem CID 25197463) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is cis-(1R,3S)-2-(2-hydroxyethyl)-5,5-dimethoxycyclohexane-1,2,3-triol.
| Compound Name | cis-(1R,3S)-2-(2-hydroxyethyl)-5,5-dimethoxycyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 25197463 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | cis-(1R,3S)-2-(2-hydroxyethyl)-5,5-dimethoxycyclohexane-1,2,3-triol |
| SMILES | COC1(OC)C[C@@H](O)C(O)(CCO)[C@@H](O)C1 |
| InChI | InChI=1S/C10H20O6/c1-15-9(16-2)5-7(12)10(14,3-4-11)8(13)6-9/h7-8,11-14H,3-6H2,1-2H3/t7-,8+,10? |
| InChIKey | DPGDDSKFDHVLDF-JWHQNHQBSA-N |
| XLogP | -1.40 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|