C10H7F5O4S — CID 25197578
(2,3,4,5,6-pentafluorophenyl) 3-oxobutane-1-sulfonate (PubChem CID 25197578) has the molecular formula C10H7F5O4S and a molecular weight of 318.22 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-oxobutane-1-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-oxobutane-1-sulfonate |
|---|---|
| PubChem CID | 25197578 |
| Molecular Formula | C10H7F5O4S |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-oxobutane-1-sulfonate |
| SMILES | CC(=O)CCS(=O)(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F5O4S/c1-4(16)2-3-20(17,18)19-10-8(14)6(12)5(11)7(13)9(10)15/h2-3H2,1H3 |
| InChIKey | FKKVMGXUDSWKDM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|