C28H40O4Si — CID 25197737
(4R,5S,6R)-6-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxane-4-carbaldehyde (PubChem CID 25197737) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (4R,5S,6R)-6-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (4R,5S,6R)-6-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 25197737 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (4R,5S,6R)-6-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxane-4-carbaldehyde |
| SMILES | C[C@@H]([C@@H]1OC(C)(C)O[C@@H](C=O)[C@H]1C)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O4Si/c1-20(26-21(2)25(19-29)30-28(7,8)31-26)22(3)32-33(27(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-22,25-26H,1-8H3/t20-,21-,22+,25+,26+/m1/s1 |
| InChIKey | GCXZDJIUCMRWRY-CYAFDCGGSA-N |
| XLogP | 4.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|