C30H42O6Si — CID 25197880
(2R,3R,4aS,6R,7S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carbaldehyde (PubChem CID 25197880) has the molecular formula C30H42O6Si and a molecular weight of 526.75 g/mol. Its IUPAC name is (2R,3R,4aS,6R,7S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carbaldehyde.
| Compound Name | (2R,3R,4aS,6R,7S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carbaldehyde |
|---|---|
| PubChem CID | 25197880 |
| Molecular Formula | C30H42O6Si |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | (2R,3R,4aS,6R,7S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)C[C@H]2O[C@H]1C=O |
| InChI | InChI=1S/C30H42O6Si/c1-30(2,3)37(4,5)36-27-17-26-25(34-28(27)18-31)16-24(33-20-23-14-10-7-11-15-23)29(35-26)21-32-19-22-12-8-6-9-13-22/h6-15,18,24-29H,16-17,19-21H2,1-5H3/t24-,25+,26-,27+,28-,29+/m0/s1 |
| InChIKey | DUSCYRDOWUZGRD-IRXUJKQFSA-N |
| XLogP | 5.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|