About trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane
trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane (PubChem CID 25198015) has the molecular formula C20H35NO2SSi
and a molecular weight of 381.66 g/mol. Its IUPAC name is trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane.
Molecular Properties
| Compound Name | trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane |
| PubChem CID | 25198015 |
| Molecular Formula | C20H35NO2SSi |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CC2[Si](C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C20H35NO2SSi/c1-13(2)16-10-17(14(3)4)20(18(11-16)15(5)6)24(22,23)21-12-19(21)25(7,8)9/h10-11,13-15,19H,12H2,1-9H3 |
| InChIKey | CYTBGXKDWGRURA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane?
The IUPAC name of trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane (CID 25198015) is trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane.
What is the SMILES notation for trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane?
The canonical SMILES for trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane is CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CC2[Si](C)(C)C)c(C(C)C)c1.
What is the InChIKey of trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane?
The InChIKey is CYTBGXKDWGRURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO2SSi/c1-13(2)16-10-17(14(3)4)20(18(11-16)15(5)6)24(22,23)21-12-19(21)25(7,8)9/h10-11,13-15,19H,12H2,1-9H3.
What are the key properties of trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane?
trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane has a molecular weight of 381.66 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridin-2-yl]silane is sourced from PubChem (CID 25198015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).