C8H12N2O2 — CID 25198083
2,2,6-trimethyl-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 25198083) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,2,6-trimethyl-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 2,2,6-trimethyl-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 25198083 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2,2,6-trimethyl-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | CN1C(=O)NC2(CC2(C)C)C1=O |
| InChI | InChI=1S/C8H12N2O2/c1-7(2)4-8(7)5(11)10(3)6(12)9-8/h4H2,1-3H3,(H,9,12) |
| InChIKey | UFTUDPQVJMOJDU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|