C17H21N3O7 — CID 25198101
[(2R,3R,4R,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 1-benzyl-5-methyltriazole-4-carboxylate (PubChem CID 25198101) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 1-benzyl-5-methyltriazole-4-carboxylate.
| Compound Name | [(2R,3R,4R,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 1-benzyl-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 25198101 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 1-benzyl-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)O[C@H]2[C@@H](O)[C@H](O)O[C@H](CO)[C@H]2O)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C17H21N3O7/c1-9-12(18-19-20(9)7-10-5-3-2-4-6-10)16(24)27-15-13(22)11(8-21)26-17(25)14(15)23/h2-6,11,13-15,17,21-23,25H,7-8H2,1H3/t11-,13-,14-,15-,17-/m1/s1 |
| InChIKey | UGVPDEIBFIRVFC-WDGOXLLCSA-N |
| XLogP | -1.41 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |