About (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine
(2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine (PubChem CID 25198147) has the molecular formula C9H18BrN
and a molecular weight of 220.15 g/mol. Its IUPAC name is (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine |
| PubChem CID | 25198147 |
| Molecular Formula | C9H18BrN |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CC[C@@](C)(Br)[C@@H]1C |
| InChI | InChI=1S/C9H18BrN/c1-7(2)11-6-5-9(4,10)8(11)3/h7-8H,5-6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | GBCUGQPGSCKRPR-DTWKUNHWSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine?
The IUPAC name of (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine (CID 25198147) is (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine.
What is the SMILES notation for (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine?
The canonical SMILES for (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine is CC(C)N1CC[C@@](C)(Br)[C@@H]1C.
What is the InChIKey of (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine?
The InChIKey is GBCUGQPGSCKRPR-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H18BrN/c1-7(2)11-6-5-9(4,10)8(11)3/h7-8H,5-6H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine?
(2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine has a molecular weight of 220.15 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine is sourced from PubChem (CID 25198147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).