C19H31NO2S — CID 25198448
2,2-dimethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridine (PubChem CID 25198448) has the molecular formula C19H31NO2S and a molecular weight of 337.53 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridine.
| Compound Name | 2,2-dimethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridine |
|---|---|
| PubChem CID | 25198448 |
| Molecular Formula | C19H31NO2S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2,2-dimethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylaziridine |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CC2(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C19H31NO2S/c1-12(2)15-9-16(13(3)4)18(17(10-15)14(5)6)23(21,22)20-11-19(20,7)8/h9-10,12-14H,11H2,1-8H3 |
| InChIKey | NUFKBHGYOZMXIS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|