C18H29NOS2 — CID 25198481
N-[(1'S,2'R,3'R,5'S,6'S,8'R)-2',8'-dimethyl-5'-propan-2-ylspiro[1,3-dithiolane-2,7'-tricyclo[4.3.1.03,8]decane]-2'-yl]formamide (PubChem CID 25198481) has the molecular formula C18H29NOS2 and a molecular weight of 339.57 g/mol. Its IUPAC name is N-[(1'S,2'R,3'R,5'S,6'S,8'R)-2',8'-dimethyl-5'-propan-2-ylspiro[1,3-dithiolane-2,7'-tricyclo[4.3.1.03,8]decane]-2'-yl]formamide.
| Compound Name | N-[(1'S,2'R,3'R,5'S,6'S,8'R)-2',8'-dimethyl-5'-propan-2-ylspiro[1,3-dithiolane-2,7'-tricyclo[4.3.1.03,8]decane]-2'-yl]formamide |
|---|---|
| PubChem CID | 25198481 |
| Molecular Formula | C18H29NOS2 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(1'S,2'R,3'R,5'S,6'S,8'R)-2',8'-dimethyl-5'-propan-2-ylspiro[1,3-dithiolane-2,7'-tricyclo[4.3.1.03,8]decane]-2'-yl]formamide |
| SMILES | CC(C)[C@@H]1C[C@H]2[C@](C)(NC=O)[C@H]3C[C@@H]1C1(SCCS1)[C@]2(C)C3 |
| InChI | InChI=1S/C18H29NOS2/c1-11(2)13-8-15-16(3)9-12(17(15,4)19-10-20)7-14(13)18(16)21-5-6-22-18/h10-15H,5-9H2,1-4H3,(H,19,20)/t12-,13-,14-,15+,16+,17+/m0/s1 |
| InChIKey | SYMOJRHHLPJJSI-OVYBAWALSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|