C13H18F3N3O4 — CID 25198598
2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-pyrrolidine-2-carboxylate;2,2,2-trifluoroacetate (PubChem CID 25198598) has the molecular formula C13H18F3N3O4 and a molecular weight of 337.30 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-pyrrolidine-2-carboxylate;2,2,2-trifluoroacetate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-pyrrolidine-2-carboxylate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 25198598 |
| Molecular Formula | C13H18F3N3O4 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-pyrrolidine-2-carboxylate;2,2,2-trifluoroacetate |
| SMILES | C[n+]1ccn(CCOC(=O)[C@@H]2CCCN2)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H18N3O2.C2HF3O2/c1-13-5-6-14(9-13)7-8-16-11(15)10-3-2-4-12-10;3-2(4,5)1(6)7/h5-6,9-10,12H,2-4,7-8H2,1H3;(H,6,7)/q+1;/p-1/t10-;/m0./s1 |
| InChIKey | TVINOUANLDBCJI-PPHPATTJSA-M |
| XLogP | -1.09 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|