C13H13ClN4O3 — CID 25199191
ethyl 2-[5-amino-1-(4-chlorobenzoyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 25199191) has the molecular formula C13H13ClN4O3 and a molecular weight of 308.73 g/mol. Its IUPAC name is ethyl 2-[5-amino-1-(4-chlorobenzoyl)-1,2,4-triazol-3-yl]acetate.
| Compound Name | ethyl 2-[5-amino-1-(4-chlorobenzoyl)-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 25199191 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | ethyl 2-[5-amino-1-(4-chlorobenzoyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(N)n(C(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H13ClN4O3/c1-2-21-11(19)7-10-16-13(15)18(17-10)12(20)8-3-5-9(14)6-4-8/h3-6H,2,7H2,1H3,(H2,15,16,17) |
| InChIKey | NLNDNJMVIAXTGW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |