C19H32OSi — CID 25199274
1-[(3aS,7aS)-3-ethenyl-3a,7,7-trimethyl-4,5,6,7a-tetrahydro-1H-inden-2-yl]ethenoxy-trimethylsilane (PubChem CID 25199274) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is 1-[(3aS,7aS)-3-ethenyl-3a,7,7-trimethyl-4,5,6,7a-tetrahydro-1H-inden-2-yl]ethenoxy-trimethylsilane.
| Compound Name | 1-[(3aS,7aS)-3-ethenyl-3a,7,7-trimethyl-4,5,6,7a-tetrahydro-1H-inden-2-yl]ethenoxy-trimethylsilane |
|---|---|
| PubChem CID | 25199274 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[(3aS,7aS)-3-ethenyl-3a,7,7-trimethyl-4,5,6,7a-tetrahydro-1H-inden-2-yl]ethenoxy-trimethylsilane |
| SMILES | C=CC1=C(C(=C)O[Si](C)(C)C)C[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C19H32OSi/c1-9-16-15(14(2)20-21(6,7)8)13-17-18(3,4)11-10-12-19(16,17)5/h9,17H,1-2,10-13H2,3-8H3/t17-,19+/m0/s1 |
| InChIKey | HJPLHEBHGHYNBR-PKOBYXMFSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|