C22H42N4O10 — CID 25199392
(2R,3R,4R,5S)-1-[3-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]propyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 25199392) has the molecular formula C22H42N4O10 and a molecular weight of 522.60 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[3-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]propyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[3-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]propyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 25199392 |
| Molecular Formula | C22H42N4O10 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (2R,3R,4R,5S)-1-[3-[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]propyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OCCOCCOCCOCCOCCOCc1cn(CCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)nn1 |
| InChI | InChI=1S/C22H42N4O10/c27-4-5-32-6-7-33-8-9-34-10-11-35-12-13-36-17-18-14-26(24-23-18)3-1-2-25-15-20(29)22(31)21(30)19(25)16-28/h14,19-22,27-31H,1-13,15-17H2/t19-,20+,21-,22-/m1/s1 |
| InChIKey | OYUTZGWNNXXGTQ-CIAFKFPVSA-N |
| XLogP | -3.00 |
| TPSA | 181.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|