C21H40O4Si — CID 25199404
methyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxytetradeca-6,8-dienoate (PubChem CID 25199404) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is methyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxytetradeca-6,8-dienoate.
| Compound Name | methyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxytetradeca-6,8-dienoate |
|---|---|
| PubChem CID | 25199404 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | methyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxytetradeca-6,8-dienoate |
| SMILES | CCCCC/C=C/C=C/[C@@H](C[C@H](O)CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-8-9-10-11-12-13-14-15-19(16-18(22)17-20(23)24-5)25-26(6,7)21(2,3)4/h12-15,18-19,22H,8-11,16-17H2,1-7H3/b13-12+,15-14+/t18-,19-/m0/s1 |
| InChIKey | PRMJRDNPNCNSQO-STFGHXIISA-N |
| XLogP | 5.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|